C16H18FNO4 — CID 744481
ethyl 6-ethoxy-1-ethyl-7-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 744481) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is ethyl 6-ethoxy-1-ethyl-7-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 6-ethoxy-1-ethyl-7-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 744481 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | ethyl 6-ethoxy-1-ethyl-7-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CC)c2cc(F)c(OCC)cc2c1=O |
| InChI | InChI=1S/C16H18FNO4/c1-4-18-9-11(16(20)22-6-3)15(19)10-7-14(21-5-2)12(17)8-13(10)18/h7-9H,4-6H2,1-3H3 |
| InChIKey | BZOBQKLCIJHVQP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |