C16H13F4NO3 — CID 53415822
ethyl 6-fluoro-4-oxo-1-prop-2-enyl-7-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 53415822) has the molecular formula C16H13F4NO3 and a molecular weight of 343.28 g/mol. Its IUPAC name is ethyl 6-fluoro-4-oxo-1-prop-2-enyl-7-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 6-fluoro-4-oxo-1-prop-2-enyl-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 53415822 |
| Molecular Formula | C16H13F4NO3 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | ethyl 6-fluoro-4-oxo-1-prop-2-enyl-7-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | C=CCn1cc(C(=O)OCC)c(=O)c2cc(F)c(C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H13F4NO3/c1-3-5-21-8-10(15(23)24-4-2)14(22)9-6-12(17)11(7-13(9)21)16(18,19)20/h3,6-8H,1,4-5H2,2H3 |
| InChIKey | PZQQYDUFJYLEJY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|