C16H14F3NO3 — CID 15717523
ethyl 1-but-3-en-2-yl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate (PubChem CID 15717523) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is ethyl 1-but-3-en-2-yl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-but-3-en-2-yl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 15717523 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | ethyl 1-but-3-en-2-yl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate |
| SMILES | C=CC(C)n1cc(C(=O)OCC)c(=O)c2cc(F)c(F)c(F)c21 |
| InChI | InChI=1S/C16H14F3NO3/c1-4-8(3)20-7-10(16(22)23-5-2)15(21)9-6-11(17)12(18)13(19)14(9)20/h4,6-8H,1,5H2,2-3H3 |
| InChIKey | BKPIYFHBRBUXNZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|