C15H14F3NO3 — CID 167360941
ethyl 5,6,7-trifluoro-4-oxo-1-propan-2-ylquinoline-3-carboxylate (PubChem CID 167360941) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is ethyl 5,6,7-trifluoro-4-oxo-1-propan-2-ylquinoline-3-carboxylate.
| Compound Name | ethyl 5,6,7-trifluoro-4-oxo-1-propan-2-ylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 167360941 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | ethyl 5,6,7-trifluoro-4-oxo-1-propan-2-ylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C(C)C)c2cc(F)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C15H14F3NO3/c1-4-22-15(21)8-6-19(7(2)3)10-5-9(16)12(17)13(18)11(10)14(8)20/h5-7H,4H2,1-3H3 |
| InChIKey | NXRAHARQXNQZBR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|