C15H14F3NO3 — CID 14651269
ethyl 1-ethyl-6,7,8-trifluoro-5-methyl-4-oxoquinoline-3-carboxylate (PubChem CID 14651269) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is ethyl 1-ethyl-6,7,8-trifluoro-5-methyl-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-ethyl-6,7,8-trifluoro-5-methyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 14651269 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | ethyl 1-ethyl-6,7,8-trifluoro-5-methyl-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CC)c2c(F)c(F)c(F)c(C)c2c1=O |
| InChI | InChI=1S/C15H14F3NO3/c1-4-19-6-8(15(21)22-5-2)14(20)9-7(3)10(16)11(17)12(18)13(9)19/h6H,4-5H2,1-3H3 |
| InChIKey | WYPVYMBKTJKKHJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|