C15H12F3NO3 — CID 14651281
ethyl 1-ethenyl-6,7,8-trifluoro-5-methyl-4-oxoquinoline-3-carboxylate (PubChem CID 14651281) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is ethyl 1-ethenyl-6,7,8-trifluoro-5-methyl-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-ethenyl-6,7,8-trifluoro-5-methyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 14651281 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | ethyl 1-ethenyl-6,7,8-trifluoro-5-methyl-4-oxoquinoline-3-carboxylate |
| SMILES | C=Cn1cc(C(=O)OCC)c(=O)c2c(C)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C15H12F3NO3/c1-4-19-6-8(15(21)22-5-2)14(20)9-7(3)10(16)11(17)12(18)13(9)19/h4,6H,1,5H2,2-3H3 |
| InChIKey | KPFOSAHCWLOPII-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|