C19H18F2N2O4 — CID 139799461
ethyl 1-cyclopropyl-6,7-difluoro-8-methyl-4-oxo-5-(prop-2-enoylamino)quinoline-3-carboxylate (PubChem CID 139799461) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-6,7-difluoro-8-methyl-4-oxo-5-(prop-2-enoylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-6,7-difluoro-8-methyl-4-oxo-5-(prop-2-enoylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 139799461 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | ethyl 1-cyclopropyl-6,7-difluoro-8-methyl-4-oxo-5-(prop-2-enoylamino)quinoline-3-carboxylate |
| SMILES | C=CC(=O)Nc1c(F)c(F)c(C)c2c1c(=O)c(C(=O)OCC)cn2C1CC1 |
| InChI | InChI=1S/C19H18F2N2O4/c1-4-12(24)22-16-13-17(9(3)14(20)15(16)21)23(10-6-7-10)8-11(18(13)25)19(26)27-5-2/h4,8,10H,1,5-7H2,2-3H3,(H,22,24) |
| InChIKey | CDOYGFKEKSEPDJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|