C15H12BrF2NO3 — CID 11046932
ethyl 8-bromo-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate (PubChem CID 11046932) has the molecular formula C15H12BrF2NO3 and a molecular weight of 372.17 g/mol. Its IUPAC name is ethyl 8-bromo-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 8-bromo-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11046932 |
| Molecular Formula | C15H12BrF2NO3 |
| Molecular Weight | 372.17 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | ethyl 8-bromo-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(Br)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C15H12BrF2NO3/c1-2-22-15(21)9-6-19(7-3-4-7)13-8(14(9)20)5-10(17)12(18)11(13)16/h5-7H,2-4H2,1H3 |
| InChIKey | MBIVSPDDSIIZOQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.17 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|