C18H16F3NO5 — CID 10524013
diethyl 1-cyclopropyl-5,7,8-trifluoro-4-oxoquinoline-3,6-dicarboxylate (PubChem CID 10524013) has the molecular formula C18H16F3NO5 and a molecular weight of 383.32 g/mol. Its IUPAC name is diethyl 1-cyclopropyl-5,7,8-trifluoro-4-oxoquinoline-3,6-dicarboxylate.
| Compound Name | diethyl 1-cyclopropyl-5,7,8-trifluoro-4-oxoquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 10524013 |
| Molecular Formula | C18H16F3NO5 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | diethyl 1-cyclopropyl-5,7,8-trifluoro-4-oxoquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(F)c(F)c2c(c1F)c(=O)c(C(=O)OCC)cn2C1CC1 |
| InChI | InChI=1S/C18H16F3NO5/c1-3-26-17(24)9-7-22(8-5-6-8)15-11(16(9)23)12(19)10(13(20)14(15)21)18(25)27-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | ZTICQEKDOAPMFF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|