C20H17F3N2O5 — CID 54477995
ethyl 7-[2-(2-cyanoethoxy)-2-oxoethyl]-1-cyclopropyl-5,6,8-trifluoro-4-oxoquinoline-3-carboxylate (PubChem CID 54477995) has the molecular formula C20H17F3N2O5 and a molecular weight of 422.36 g/mol. Its IUPAC name is ethyl 7-[2-(2-cyanoethoxy)-2-oxoethyl]-1-cyclopropyl-5,6,8-trifluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-[2-(2-cyanoethoxy)-2-oxoethyl]-1-cyclopropyl-5,6,8-trifluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 54477995 |
| Molecular Formula | C20H17F3N2O5 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | ethyl 7-[2-(2-cyanoethoxy)-2-oxoethyl]-1-cyclopropyl-5,6,8-trifluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(F)c(CC(=O)OCCC#N)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C20H17F3N2O5/c1-2-29-20(28)12-9-25(10-4-5-10)18-14(19(12)27)17(23)15(21)11(16(18)22)8-13(26)30-7-3-6-24/h9-10H,2-5,7-8H2,1H3 |
| InChIKey | XMYJDCHPAGOTHL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 98.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|