C19H16F2N2O5 — CID 70374681
methyl 7-[2-(2-cyanoethoxy)-2-oxoethyl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylate (PubChem CID 70374681) has the molecular formula C19H16F2N2O5 and a molecular weight of 390.34 g/mol. Its IUPAC name is methyl 7-[2-(2-cyanoethoxy)-2-oxoethyl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | methyl 7-[2-(2-cyanoethoxy)-2-oxoethyl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 70374681 |
| Molecular Formula | C19H16F2N2O5 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | methyl 7-[2-(2-cyanoethoxy)-2-oxoethyl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylate |
| SMILES | COC(=O)c1cn(C2CC2)c2c(F)c(CC(=O)OCCC#N)c(F)cc2c1=O |
| InChI | InChI=1S/C19H16F2N2O5/c1-27-19(26)13-9-23(10-3-4-10)17-12(18(13)25)7-14(20)11(16(17)21)8-15(24)28-6-2-5-22/h7,9-10H,2-4,6,8H2,1H3 |
| InChIKey | KZTZUNONAWBEFN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 98.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|