C14H12F2N2O3 — CID 24952472
1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxamide (PubChem CID 24952472) has the molecular formula C14H12F2N2O3 and a molecular weight of 294.26 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxamide.
| Compound Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 24952472 |
| Molecular Formula | C14H12F2N2O3 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxamide |
| SMILES | COc1c(F)c(F)cc2c(=O)c(C(N)=O)cn(C3CC3)c12 |
| InChI | InChI=1S/C14H12F2N2O3/c1-21-13-10(16)9(15)4-7-11(13)18(6-2-3-6)5-8(12(7)19)14(17)20/h4-6H,2-3H2,1H3,(H2,17,20) |
| InChIKey | YVXVRZSCZMFMPM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |