C26H28F2N4O3 — CID 167956724
1-cyclopropyl-6,7-difluoro-8-methoxy-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-oxoquinoline-3-carboxamide (PubChem CID 167956724) has the molecular formula C26H28F2N4O3 and a molecular weight of 482.53 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-difluoro-8-methoxy-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 167956724 |
| Molecular Formula | C26H28F2N4O3 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-oxoquinoline-3-carboxamide |
| SMILES | COc1c(F)c(F)cc2c(=O)c(C(=O)Nc3ccc(N4CCN(C)CC4)cc3C)cn(C3CC3)c12 |
| InChI | InChI=1S/C26H28F2N4O3/c1-15-12-17(31-10-8-30(2)9-11-31)6-7-21(15)29-26(34)19-14-32(16-4-5-16)23-18(24(19)33)13-20(27)22(28)25(23)35-3/h6-7,12-14,16H,4-5,8-11H2,1-3H3,(H,29,34) |
| InChIKey | UUHJHGRFLXLODI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|