C14H11F2NO3 — CID 89425117
1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carbaldehyde (PubChem CID 89425117) has the molecular formula C14H11F2NO3 and a molecular weight of 279.24 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carbaldehyde.
| Compound Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 89425117 |
| Molecular Formula | C14H11F2NO3 |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carbaldehyde |
| SMILES | COc1c(F)c(F)cc2c(=O)c(C=O)cn(C3CC3)c12 |
| InChI | InChI=1S/C14H11F2NO3/c1-20-14-11(16)10(15)4-9-12(14)17(8-2-3-8)5-7(6-18)13(9)19/h4-6,8H,2-3H2,1H3 |
| InChIKey | KQYUTJXYJTWBGJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|