C14H14BF2NO7 — CID 66924300
boric acid;1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 66924300) has the molecular formula C14H14BF2NO7 and a molecular weight of 357.07 g/mol. Its IUPAC name is boric acid;1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | boric acid;1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 66924300 |
| Molecular Formula | C14H14BF2NO7 |
| Molecular Weight | 357.07 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | boric acid;1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(F)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12.OB(O)O |
| InChI | InChI=1S/C14H11F2NO4.BH3O3/c1-21-13-10(16)9(15)4-7-11(13)17(6-2-3-6)5-8(12(7)18)14(19)20;2-1(3)4/h4-6H,2-3H2,1H3,(H,19,20);2-4H |
| InChIKey | MDPCYVCHRVCQFL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.07 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|