C21H22FNO6 — CID 19072269
7-(1-carboxycyclohexyl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 19072269) has the molecular formula C21H22FNO6 and a molecular weight of 403.41 g/mol. Its IUPAC name is 7-(1-carboxycyclohexyl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(1-carboxycyclohexyl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19072269 |
| Molecular Formula | C21H22FNO6 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 7-(1-carboxycyclohexyl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(C2(C(=O)O)CCCCC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C21H22FNO6/c1-29-18-15(21(20(27)28)7-3-2-4-8-21)14(22)9-12-16(18)23(11-5-6-11)10-13(17(12)24)19(25)26/h9-11H,2-8H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | KCCOELJDOWGOQP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |