C22H18F2N4O2S — CID 52947336
1-cyclopropyl-6,7-difluoro-8-methoxy-3-[4-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]quinolin-4-one (PubChem CID 52947336) has the molecular formula C22H18F2N4O2S and a molecular weight of 440.48 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-difluoro-8-methoxy-3-[4-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]quinolin-4-one.
| Compound Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-3-[4-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]quinolin-4-one |
|---|---|
| PubChem CID | 52947336 |
| Molecular Formula | C22H18F2N4O2S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-3-[4-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]quinolin-4-one |
| SMILES | COc1c(F)c(F)cc2c(=O)c(-c3n[nH]c(=S)n3-c3ccccc3C)cn(C3CC3)c12 |
| InChI | InChI=1S/C22H18F2N4O2S/c1-11-5-3-4-6-16(11)28-21(25-26-22(28)31)14-10-27(12-7-8-12)18-13(19(14)29)9-15(23)17(24)20(18)30-2/h3-6,9-10,12H,7-8H2,1-2H3,(H,26,31) |
| InChIKey | BNCJURCTYUFBKX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|