C31H28FNO6 — CID 54148077
ethyl 1-cyclopropyl-6-fluoro-8-methoxy-7-(2-methoxy-2-oxo-1,1-diphenylethyl)-4-oxoquinoline-3-carboxylate (PubChem CID 54148077) has the molecular formula C31H28FNO6 and a molecular weight of 529.56 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-6-fluoro-8-methoxy-7-(2-methoxy-2-oxo-1,1-diphenylethyl)-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-6-fluoro-8-methoxy-7-(2-methoxy-2-oxo-1,1-diphenylethyl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 54148077 |
| Molecular Formula | C31H28FNO6 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | ethyl 1-cyclopropyl-6-fluoro-8-methoxy-7-(2-methoxy-2-oxo-1,1-diphenylethyl)-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(OC)c(C(C(=O)OC)(c3ccccc3)c3ccccc3)c(F)cc2c1=O |
| InChI | InChI=1S/C31H28FNO6/c1-4-39-29(35)23-18-33(21-15-16-21)26-22(27(23)34)17-24(32)25(28(26)37-2)31(30(36)38-3,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,17-18,21H,4,15-16H2,1-3H3 |
| InChIKey | OFUAOEQTHKNTPC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|