C24H19FN4O3 — CID 25068275
ethyl 15-cyclopropyl-21-fluoro-10-methyl-18-oxo-2,10,12,15-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),2,4,6,8,11,13,16,19-nonaene-17-carboxylate (PubChem CID 25068275) has the molecular formula C24H19FN4O3 and a molecular weight of 430.44 g/mol. Its IUPAC name is ethyl 15-cyclopropyl-21-fluoro-10-methyl-18-oxo-2,10,12,15-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),2,4,6,8,11,13,16,19-nonaene-17-carboxylate.
| Compound Name | ethyl 15-cyclopropyl-21-fluoro-10-methyl-18-oxo-2,10,12,15-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),2,4,6,8,11,13,16,19-nonaene-17-carboxylate |
|---|---|
| PubChem CID | 25068275 |
| Molecular Formula | C24H19FN4O3 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | ethyl 15-cyclopropyl-21-fluoro-10-methyl-18-oxo-2,10,12,15-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),2,4,6,8,11,13,16,19-nonaene-17-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(cc(F)c3nc4c5ccccc5n(C)c4nc32)c1=O |
| InChI | InChI=1S/C24H19FN4O3/c1-3-32-24(31)15-11-29(12-8-9-12)21-14(22(15)30)10-16(25)19-20(21)27-23-18(26-19)13-6-4-5-7-17(13)28(23)2/h4-7,10-12H,3,8-9H2,1-2H3 |
| InChIKey | JFTCKWLUAILJBT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|