C18H18FNO4 — CID 11724246
ethyl 1-cyclopropyl-6-fluoro-7-(3-hydroxyprop-1-en-2-yl)-4-oxoquinoline-3-carboxylate (PubChem CID 11724246) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-6-fluoro-7-(3-hydroxyprop-1-en-2-yl)-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-6-fluoro-7-(3-hydroxyprop-1-en-2-yl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11724246 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | ethyl 1-cyclopropyl-6-fluoro-7-(3-hydroxyprop-1-en-2-yl)-4-oxoquinoline-3-carboxylate |
| SMILES | C=C(CO)c1cc2c(cc1F)c(=O)c(C(=O)OCC)cn2C1CC1 |
| InChI | InChI=1S/C18H18FNO4/c1-3-24-18(23)14-8-20(11-4-5-11)16-7-12(10(2)9-21)15(19)6-13(16)17(14)22/h6-8,11,21H,2-5,9H2,1H3 |
| InChIKey | QQNCMEMMLIRVII-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |