C19H19FN4O3 — CID 10044640
ethyl 7-[2-(azidomethyl)cyclopropyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 10044640) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is ethyl 7-[2-(azidomethyl)cyclopropyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-[2-(azidomethyl)cyclopropyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10044640 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl 7-[2-(azidomethyl)cyclopropyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2cc(C3CC3CN=[N+]=[N-])c(F)cc2c1=O |
| InChI | InChI=1S/C19H19FN4O3/c1-2-27-19(26)15-9-24(11-3-4-11)17-7-13(12-5-10(12)8-22-23-21)16(20)6-14(17)18(15)25/h6-7,9-12H,2-5,8H2,1H3 |
| InChIKey | BMBPHJHNOAVTTA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 97.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|