About 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate
2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 154631855) has the molecular formula C17H17ClFNO4
and a molecular weight of 353.78 g/mol. Its IUPAC name is 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| PubChem CID | 154631855 |
| Molecular Formula | C17H17ClFNO4 |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOCCOC(=O)c1cn(C2CC2)c2cc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C17H17ClFNO4/c1-2-23-5-6-24-17(22)12-9-20(10-3-4-10)15-8-13(18)14(19)7-11(15)16(12)21/h7-10H,2-6H2,1H3 |
| InChIKey | ATWQDUPTMXBLJV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate?
The IUPAC name of 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate (CID 154631855) is 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate.
What is the SMILES notation for 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate?
The canonical SMILES for 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate is CCOCCOC(=O)c1cn(C2CC2)c2cc(Cl)c(F)cc2c1=O.
What is the InChIKey of 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate?
The InChIKey is ATWQDUPTMXBLJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClFNO4/c1-2-23-5-6-24-17(22)12-9-20(10-3-4-10)15-8-13(18)14(19)7-11(15)16(12)21/h7-10H,2-6H2,1H3.
What are the key properties of 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate?
2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate has a molecular weight of 353.78 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate is sourced from PubChem (CID 154631855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).