C18H20FNO5 — CID 164817321
3-methoxypropyl 1-cyclopropyl-6-fluoro-7-methoxy-4-oxoquinoline-3-carboxylate (PubChem CID 164817321) has the molecular formula C18H20FNO5 and a molecular weight of 349.36 g/mol. Its IUPAC name is 3-methoxypropyl 1-cyclopropyl-6-fluoro-7-methoxy-4-oxoquinoline-3-carboxylate.
| Compound Name | 3-methoxypropyl 1-cyclopropyl-6-fluoro-7-methoxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 164817321 |
| Molecular Formula | C18H20FNO5 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3-methoxypropyl 1-cyclopropyl-6-fluoro-7-methoxy-4-oxoquinoline-3-carboxylate |
| SMILES | COCCCOC(=O)c1cn(C2CC2)c2cc(OC)c(F)cc2c1=O |
| InChI | InChI=1S/C18H20FNO5/c1-23-6-3-7-25-18(22)13-10-20(11-4-5-11)15-9-16(24-2)14(19)8-12(15)17(13)21/h8-11H,3-7H2,1-2H3 |
| InChIKey | FWINBCSQIVELDC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|