C18H19ClFNO4 — CID 146717195
4-methoxybutyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 146717195) has the molecular formula C18H19ClFNO4 and a molecular weight of 367.80 g/mol. Its IUPAC name is 4-methoxybutyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | 4-methoxybutyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 146717195 |
| Molecular Formula | C18H19ClFNO4 |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-methoxybutyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | COCCCCOC(=O)c1cn(C2CC2)c2cc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C18H19ClFNO4/c1-24-6-2-3-7-25-18(23)13-10-21(11-4-5-11)16-9-14(19)15(20)8-12(16)17(13)22/h8-11H,2-7H2,1H3 |
| InChIKey | REACXOAAUTXFPF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|