C16H15F2NO3 — CID 155405950
propyl 1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate (PubChem CID 155405950) has the molecular formula C16H15F2NO3 and a molecular weight of 307.30 g/mol. Its IUPAC name is propyl 1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | propyl 1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 155405950 |
| Molecular Formula | C16H15F2NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | propyl 1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCCOC(=O)c1cn(C2CC2)c2cc(F)c(F)cc2c1=O |
| InChI | InChI=1S/C16H15F2NO3/c1-2-5-22-16(21)11-8-19(9-3-4-9)14-7-13(18)12(17)6-10(14)15(11)20/h6-9H,2-5H2,1H3 |
| InChIKey | USFZOFRFDJXSHD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |