C20H19FN2O5 — CID 14422910
ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 14422910) has the molecular formula C20H19FN2O5 and a molecular weight of 386.38 g/mol. Its IUPAC name is ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 14422910 |
| Molecular Formula | C20H19FN2O5 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2cc(C(C#N)C(=O)OCC)c(F)cc2c1=O |
| InChI | InChI=1S/C20H19FN2O5/c1-3-27-19(25)14(9-22)12-8-17-13(7-16(12)21)18(24)15(20(26)28-4-2)10-23(17)11-5-6-11/h7-8,10-11,14H,3-6H2,1-2H3 |
| InChIKey | WCWGADFNXQRCCJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |