C20H18FN3O7 — CID 14422906
ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylate (PubChem CID 14422906) has the molecular formula C20H18FN3O7 and a molecular weight of 431.38 g/mol. Its IUPAC name is ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 14422906 |
| Molecular Formula | C20H18FN3O7 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | ethyl 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c([N+](=O)[O-])c(C(C#N)C(=O)OCC)c(F)cc2c1=O |
| InChI | InChI=1S/C20H18FN3O7/c1-3-30-19(26)12(8-22)15-14(21)7-11-16(17(15)24(28)29)23(10-5-6-10)9-13(18(11)25)20(27)31-4-2/h7,9-10,12H,3-6H2,1-2H3 |
| InChIKey | FQAOTAYWTUIOSA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 141.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|