C19H20FN3O7 — CID 67024103
7-[(1-carboxy-3-methylbutyl)amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 67024103) has the molecular formula C19H20FN3O7 and a molecular weight of 421.38 g/mol. Its IUPAC name is 7-[(1-carboxy-3-methylbutyl)amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(1-carboxy-3-methylbutyl)amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67024103 |
| Molecular Formula | C19H20FN3O7 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 7-[(1-carboxy-3-methylbutyl)amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CC(C)CC(Nc1c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c2c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C19H20FN3O7/c1-8(2)5-13(19(27)28)21-14-12(20)6-10-15(16(14)23(29)30)22(9-3-4-9)7-11(17(10)24)18(25)26/h6-9,13,21H,3-5H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | MRDMNYLVYDZHBP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 151.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|