C18H16FN3O8 — CID 23652617
7-(2-carboxy-4-hydroxypyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 23652617) has the molecular formula C18H16FN3O8 and a molecular weight of 421.34 g/mol. Its IUPAC name is 7-(2-carboxy-4-hydroxypyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(2-carboxy-4-hydroxypyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23652617 |
| Molecular Formula | C18H16FN3O8 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 7-(2-carboxy-4-hydroxypyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2c([N+](=O)[O-])c(N3CC(O)CC3C(=O)O)c(F)cc2c1=O |
| InChI | InChI=1S/C18H16FN3O8/c19-11-4-9-13(20(7-1-2-7)6-10(16(9)24)17(25)26)15(22(29)30)14(11)21-5-8(23)3-12(21)18(27)28/h4,6-8,12,23H,1-3,5H2,(H,25,26)(H,27,28) |
| InChIKey | ZZMSLVCZMDOQFO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 163.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|