C16H14FN3O8 — CID 67024116
7-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 67024116) has the molecular formula C16H14FN3O8 and a molecular weight of 395.30 g/mol. Its IUPAC name is 7-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67024116 |
| Molecular Formula | C16H14FN3O8 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 7-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2c([N+](=O)[O-])c(N[C@@H](CO)C(=O)O)c(F)cc2c1=O |
| InChI | InChI=1S/C16H14FN3O8/c17-9-3-7-12(13(20(27)28)11(9)18-10(5-21)16(25)26)19(6-1-2-6)4-8(14(7)22)15(23)24/h3-4,6,10,18,21H,1-2,5H2,(H,23,24)(H,25,26)/t10-/m0/s1 |
| InChIKey | FMVQMWVVTACPST-JTQLQIEISA-N |
| XLogP | 0.94 |
| TPSA | 172.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|