C14H10F2N2O5 — CID 23364523
1-cyclopropyl-6,7-difluoro-5-methyl-8-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 23364523) has the molecular formula C14H10F2N2O5 and a molecular weight of 324.24 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-difluoro-5-methyl-8-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6,7-difluoro-5-methyl-8-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23364523 |
| Molecular Formula | C14H10F2N2O5 |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-cyclopropyl-6,7-difluoro-5-methyl-8-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | Cc1c(F)c(F)c([N+](=O)[O-])c2c1c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C14H10F2N2O5/c1-5-8-11(12(18(22)23)10(16)9(5)15)17(6-2-3-6)4-7(13(8)19)14(20)21/h4,6H,2-3H2,1H3,(H,20,21) |
| InChIKey | PYBMMHKQXOJHQV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|