C13H8F2N2O5 — CID 13377176
5,6-difluoro-2-methyl-7-nitro-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-10-carboxylic acid (PubChem CID 13377176) has the molecular formula C13H8F2N2O5 and a molecular weight of 310.21 g/mol. Its IUPAC name is 5,6-difluoro-2-methyl-7-nitro-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-10-carboxylic acid.
| Compound Name | 5,6-difluoro-2-methyl-7-nitro-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-10-carboxylic acid |
|---|---|
| PubChem CID | 13377176 |
| Molecular Formula | C13H8F2N2O5 |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 5,6-difluoro-2-methyl-7-nitro-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-10-carboxylic acid |
| SMILES | CC1Cc2c(F)c(F)c([N+](=O)[O-])c3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C13H8F2N2O5/c1-4-2-5-8(14)9(15)11(17(21)22)7-10(5)16(4)3-6(12(7)18)13(19)20/h3-4H,2H2,1H3,(H,19,20) |
| InChIKey | JYRYPXFWJCSUNZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|