C15H14N2O7 — CID 86732834
1-cyclopropyl-6,7-dimethoxy-5-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 86732834) has the molecular formula C15H14N2O7 and a molecular weight of 334.28 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-dimethoxy-5-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6,7-dimethoxy-5-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 86732834 |
| Molecular Formula | C15H14N2O7 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-cyclopropyl-6,7-dimethoxy-5-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1OC)c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C15H14N2O7/c1-23-10-5-9-11(12(17(21)22)14(10)24-2)13(18)8(15(19)20)6-16(9)7-3-4-7/h5-7H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | SCQQWOBUDIFUTA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|