C13H10ClNO5 — CID 86732837
5-chloro-1-cyclopropyl-6,7-dihydroxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 86732837) has the molecular formula C13H10ClNO5 and a molecular weight of 295.68 g/mol. Its IUPAC name is 5-chloro-1-cyclopropyl-6,7-dihydroxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-chloro-1-cyclopropyl-6,7-dihydroxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 86732837 |
| Molecular Formula | C13H10ClNO5 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 5-chloro-1-cyclopropyl-6,7-dihydroxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(O)c(O)c(Cl)c2c1=O |
| InChI | InChI=1S/C13H10ClNO5/c14-10-9-7(3-8(16)12(10)18)15(5-1-2-5)4-6(11(9)17)13(19)20/h3-5,16,18H,1-2H2,(H,19,20) |
| InChIKey | ZLGKWTIQKJQDSU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|