C13H8BrF2NO3 — CID 19379734
5-bromo-1-cyclopropyl-7,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 19379734) has the molecular formula C13H8BrF2NO3 and a molecular weight of 344.11 g/mol. Its IUPAC name is 5-bromo-1-cyclopropyl-7,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-bromo-1-cyclopropyl-7,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19379734 |
| Molecular Formula | C13H8BrF2NO3 |
| Molecular Weight | 344.11 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 5-bromo-1-cyclopropyl-7,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2c(F)c(F)cc(Br)c2c1=O |
| InChI | InChI=1S/C13H8BrF2NO3/c14-7-3-8(15)10(16)11-9(7)12(18)6(13(19)20)4-17(11)5-1-2-5/h3-5H,1-2H2,(H,19,20) |
| InChIKey | WZMZVCGCIYIMEG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|