C15H13F3N2O3S — CID 14555044
7-(2-aminoethylsulfanyl)-1-cyclopropyl-5,6,8-trifluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 14555044) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is 7-(2-aminoethylsulfanyl)-1-cyclopropyl-5,6,8-trifluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(2-aminoethylsulfanyl)-1-cyclopropyl-5,6,8-trifluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 14555044 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 7-(2-aminoethylsulfanyl)-1-cyclopropyl-5,6,8-trifluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | NCCSc1c(F)c(F)c2c(=O)c(C(=O)O)cn(C3CC3)c2c1F |
| InChI | InChI=1S/C15H13F3N2O3S/c16-9-8-12(11(18)14(10(9)17)24-4-3-19)20(6-1-2-6)5-7(13(8)21)15(22)23/h5-6H,1-4,19H2,(H,22,23) |
| InChIKey | DXFAVAQWQWGRFK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|