C16H16ClFN2O3S — CID 14661913
8-chloro-1-cyclopropyl-6-fluoro-7-[2-(methylamino)ethylsulfanyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 14661913) has the molecular formula C16H16ClFN2O3S and a molecular weight of 370.83 g/mol. Its IUPAC name is 8-chloro-1-cyclopropyl-6-fluoro-7-[2-(methylamino)ethylsulfanyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 8-chloro-1-cyclopropyl-6-fluoro-7-[2-(methylamino)ethylsulfanyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 14661913 |
| Molecular Formula | C16H16ClFN2O3S |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 8-chloro-1-cyclopropyl-6-fluoro-7-[2-(methylamino)ethylsulfanyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CNCCSc1c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c2c1Cl |
| InChI | InChI=1S/C16H16ClFN2O3S/c1-19-4-5-24-15-11(18)6-9-13(12(15)17)20(8-2-3-8)7-10(14(9)21)16(22)23/h6-8,19H,2-5H2,1H3,(H,22,23) |
| InChIKey | CHMQMFGFOQKXFJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|