C16H15F2N3O3 — CID 10042562
5-amino-7-(1-aminocyclopropyl)-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 10042562) has the molecular formula C16H15F2N3O3 and a molecular weight of 335.31 g/mol. Its IUPAC name is 5-amino-7-(1-aminocyclopropyl)-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-7-(1-aminocyclopropyl)-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10042562 |
| Molecular Formula | C16H15F2N3O3 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-amino-7-(1-aminocyclopropyl)-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | Nc1c(F)c(C2(N)CC2)c(F)c2c1c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C16H15F2N3O3/c17-10-9(16(20)3-4-16)11(18)13-8(12(10)19)14(22)7(15(23)24)5-21(13)6-1-2-6/h5-6H,1-4,19-20H2,(H,23,24) |
| InChIKey | MAPSGDYNFKLCCZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|