C20H28N2O4 — CID 144618072
1-cyclopropyl-6,7-dihydroxy-5-methyl-4-oxo-N-propylquinoline-3-carboxamide;propane (PubChem CID 144618072) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-dihydroxy-5-methyl-4-oxo-N-propylquinoline-3-carboxamide;propane.
| Compound Name | 1-cyclopropyl-6,7-dihydroxy-5-methyl-4-oxo-N-propylquinoline-3-carboxamide;propane |
|---|---|
| PubChem CID | 144618072 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-cyclopropyl-6,7-dihydroxy-5-methyl-4-oxo-N-propylquinoline-3-carboxamide;propane |
| SMILES | CCC.CCCNC(=O)c1cn(C2CC2)c2cc(O)c(O)c(C)c2c1=O |
| InChI | InChI=1S/C17H20N2O4.C3H8/c1-3-6-18-17(23)11-8-19(10-4-5-10)12-7-13(20)15(21)9(2)14(12)16(11)22;1-3-2/h7-8,10,20-21H,3-6H2,1-2H3,(H,18,23);3H2,1-2H3 |
| InChIKey | XMFWUFCDHPRJAY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|