C23H25ClN2O2 — CID 142006209
N-[(4-chlorophenyl)methyl]-1-cyclopropyl-6-methyl-4-oxoquinoline-3-carboxamide;ethane (PubChem CID 142006209) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-cyclopropyl-6-methyl-4-oxoquinoline-3-carboxamide;ethane.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-cyclopropyl-6-methyl-4-oxoquinoline-3-carboxamide;ethane |
|---|---|
| PubChem CID | 142006209 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-cyclopropyl-6-methyl-4-oxoquinoline-3-carboxamide;ethane |
| SMILES | CC.Cc1ccc2c(c1)c(=O)c(C(=O)NCc1ccc(Cl)cc1)cn2C1CC1 |
| InChI | InChI=1S/C21H19ClN2O2.C2H6/c1-13-2-9-19-17(10-13)20(25)18(12-24(19)16-7-8-16)21(26)23-11-14-3-5-15(22)6-4-14;1-2/h2-6,9-10,12,16H,7-8,11H2,1H3,(H,23,26);1-2H3 |
| InChIKey | CNWHFNFSEWMCPF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |