C31H32ClN2NaO5 — CID 173221747
sodium;3-[3-[(4-chlorophenyl)methylcarbamoyl]-1-cyclopropyl-4-oxoquinolin-6-yl]prop-2-ynyl 7-oxooctanoate;hydride (PubChem CID 173221747) has the molecular formula C31H32ClN2NaO5 and a molecular weight of 571.05 g/mol. Its IUPAC name is sodium;3-[3-[(4-chlorophenyl)methylcarbamoyl]-1-cyclopropyl-4-oxoquinolin-6-yl]prop-2-ynyl 7-oxooctanoate;hydride.
| Compound Name | sodium;3-[3-[(4-chlorophenyl)methylcarbamoyl]-1-cyclopropyl-4-oxoquinolin-6-yl]prop-2-ynyl 7-oxooctanoate;hydride |
|---|---|
| PubChem CID | 173221747 |
| Molecular Formula | C31H32ClN2NaO5 |
| Molecular Weight | 571.05 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | sodium;3-[3-[(4-chlorophenyl)methylcarbamoyl]-1-cyclopropyl-4-oxoquinolin-6-yl]prop-2-ynyl 7-oxooctanoate;hydride |
| SMILES | CC(=O)CCCCCC(=O)OCC#Cc1ccc2c(c1)c(=O)c(C(=O)NCc1ccc(Cl)cc1)cn2C1CC1.[H-].[Na+] |
| InChI | InChI=1S/C31H31ClN2O5.Na.H/c1-21(35)6-3-2-4-8-29(36)39-17-5-7-22-11-16-28-26(18-22)30(37)27(20-34(28)25-14-15-25)31(38)33-19-23-9-12-24(32)13-10-23;;/h9-13,16,18,20,25H,2-4,6,8,14-15,17,19H2,1H3,(H,33,38);;/q;+1;-1 |
| InChIKey | MZTGNOGTYFZICJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.05 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|