C25H23ClN2O5 — CID 142006217
tert-butyl 2-[3-[(4-chlorophenyl)methylcarbamoyl]-6-(2-hydroxyethynyl)-4-oxoquinolin-1-yl]acetate (PubChem CID 142006217) has the molecular formula C25H23ClN2O5 and a molecular weight of 466.92 g/mol. Its IUPAC name is tert-butyl 2-[3-[(4-chlorophenyl)methylcarbamoyl]-6-(2-hydroxyethynyl)-4-oxoquinolin-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-[(4-chlorophenyl)methylcarbamoyl]-6-(2-hydroxyethynyl)-4-oxoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 142006217 |
| Molecular Formula | C25H23ClN2O5 |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | tert-butyl 2-[3-[(4-chlorophenyl)methylcarbamoyl]-6-(2-hydroxyethynyl)-4-oxoquinolin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)c2cc(C#CO)ccc21 |
| InChI | InChI=1S/C25H23ClN2O5/c1-25(2,3)33-22(30)15-28-14-20(24(32)27-13-17-4-7-18(26)8-5-17)23(31)19-12-16(10-11-29)6-9-21(19)28/h4-9,12,14,29H,13,15H2,1-3H3,(H,27,32) |
| InChIKey | DTECDSCAPFFTCD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|