C21H14ClFN2O4 — CID 18698488
3-[3-[(4-chlorophenyl)methylcarbamoyl]-8-fluoro-4-oxo-1H-quinolin-6-yl]prop-2-ynyl formate (PubChem CID 18698488) has the molecular formula C21H14ClFN2O4 and a molecular weight of 412.80 g/mol. Its IUPAC name is 3-[3-[(4-chlorophenyl)methylcarbamoyl]-8-fluoro-4-oxo-1H-quinolin-6-yl]prop-2-ynyl formate.
| Compound Name | 3-[3-[(4-chlorophenyl)methylcarbamoyl]-8-fluoro-4-oxo-1H-quinolin-6-yl]prop-2-ynyl formate |
|---|---|
| PubChem CID | 18698488 |
| Molecular Formula | C21H14ClFN2O4 |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-[3-[(4-chlorophenyl)methylcarbamoyl]-8-fluoro-4-oxo-1H-quinolin-6-yl]prop-2-ynyl formate |
| SMILES | O=COCC#Cc1cc(F)c2[nH]cc(C(=O)NCc3ccc(Cl)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C21H14ClFN2O4/c22-15-5-3-13(4-6-15)10-25-21(28)17-11-24-19-16(20(17)27)8-14(9-18(19)23)2-1-7-29-12-26/h3-6,8-9,11-12H,7,10H2,(H,24,27)(H,25,28) |
| InChIKey | BYKVZEXISUORNC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|