C20H18ClF2N3O3 — CID 18698646
N-[(4-chlorophenyl)methyl]-6,8-difluoro-7-(2-methoxyethylamino)-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 18698646) has the molecular formula C20H18ClF2N3O3 and a molecular weight of 421.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-6,8-difluoro-7-(2-methoxyethylamino)-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-6,8-difluoro-7-(2-methoxyethylamino)-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 18698646 |
| Molecular Formula | C20H18ClF2N3O3 |
| Molecular Weight | 421.83 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-6,8-difluoro-7-(2-methoxyethylamino)-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | COCCNc1c(F)cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)c[nH]c2c1F |
| InChI | InChI=1S/C20H18ClF2N3O3/c1-29-7-6-24-18-15(22)8-13-17(16(18)23)25-10-14(19(13)27)20(28)26-9-11-2-4-12(21)5-3-11/h2-5,8,10,24H,6-7,9H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | ALVUJIYFNVMNRM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|