C19H17ClN2O4 — CID 18698657
N-[(4-chlorophenyl)methyl]-6-(2-hydroxyethoxy)-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 18698657) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-6-(2-hydroxyethoxy)-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-6-(2-hydroxyethoxy)-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 18698657 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-6-(2-hydroxyethoxy)-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1c[nH]c2ccc(OCCO)cc2c1=O |
| InChI | InChI=1S/C19H17ClN2O4/c20-13-3-1-12(2-4-13)10-22-19(25)16-11-21-17-6-5-14(26-8-7-23)9-15(17)18(16)24/h1-6,9,11,23H,7-8,10H2,(H,21,24)(H,22,25) |
| InChIKey | OURAFKZAVBVIHG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |