C16H11BrClN3O2 — CID 20583233
6-bromo-N-[(4-chlorophenyl)methyl]-4-oxo-1H-1,7-naphthyridine-3-carboxamide (PubChem CID 20583233) has the molecular formula C16H11BrClN3O2 and a molecular weight of 392.64 g/mol. Its IUPAC name is 6-bromo-N-[(4-chlorophenyl)methyl]-4-oxo-1H-1,7-naphthyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[(4-chlorophenyl)methyl]-4-oxo-1H-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 20583233 |
| Molecular Formula | C16H11BrClN3O2 |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 6-bromo-N-[(4-chlorophenyl)methyl]-4-oxo-1H-1,7-naphthyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1c[nH]c2cnc(Br)cc2c1=O |
| InChI | InChI=1S/C16H11BrClN3O2/c17-14-5-11-13(8-20-14)19-7-12(15(11)22)16(23)21-6-9-1-3-10(18)4-2-9/h1-5,7-8H,6H2,(H,19,22)(H,21,23) |
| InChIKey | XJFBENVSSJXEJO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|