C18H14BrClN3O3Y+2 — CID 20794326
6-bromo-N-[(4-chlorophenyl)methyl]-8-ethoxy-4-oxo-1,7-naphthyridin-1-ide-3-carboxamide;yttrium(3+) (PubChem CID 20794326) has the molecular formula C18H14BrClN3O3Y+2 and a molecular weight of 524.59 g/mol. Its IUPAC name is 6-bromo-N-[(4-chlorophenyl)methyl]-8-ethoxy-4-oxo-1,7-naphthyridin-1-ide-3-carboxamide;yttrium(3+).
| Compound Name | 6-bromo-N-[(4-chlorophenyl)methyl]-8-ethoxy-4-oxo-1,7-naphthyridin-1-ide-3-carboxamide;yttrium(3+) |
|---|---|
| PubChem CID | 20794326 |
| Molecular Formula | C18H14BrClN3O3Y+2 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 522.90 |
| IUPAC Name | 6-bromo-N-[(4-chlorophenyl)methyl]-8-ethoxy-4-oxo-1,7-naphthyridin-1-ide-3-carboxamide;yttrium(3+) |
| SMILES | CCOc1nc(Br)cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)c[n-]c12.[Y+3] |
| InChI | InChI=1S/C18H15BrClN3O3.Y/c1-2-26-18-15-12(7-14(19)23-18)16(24)13(9-21-15)17(25)22-8-10-3-5-11(20)6-4-10;/h3-7,9H,2,8H2,1H3,(H2,21,22,24,25);/q;+3/p-1 |
| InChIKey | NCKJCJNBPFVAKP-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|