C17H12BrClN3O2Y- — CID 59061940
6-bromo-N-[(4-chlorophenyl)methyl]-1-methyl-4-oxo-8H-1,7-naphthyridin-8-ide-3-carboxamide;yttrium (PubChem CID 59061940) has the molecular formula C17H12BrClN3O2Y- and a molecular weight of 494.57 g/mol. Its IUPAC name is 6-bromo-N-[(4-chlorophenyl)methyl]-1-methyl-4-oxo-8H-1,7-naphthyridin-8-ide-3-carboxamide;yttrium.
| Compound Name | 6-bromo-N-[(4-chlorophenyl)methyl]-1-methyl-4-oxo-8H-1,7-naphthyridin-8-ide-3-carboxamide;yttrium |
|---|---|
| PubChem CID | 59061940 |
| Molecular Formula | C17H12BrClN3O2Y- |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 492.89 |
| IUPAC Name | 6-bromo-N-[(4-chlorophenyl)methyl]-1-methyl-4-oxo-8H-1,7-naphthyridin-8-ide-3-carboxamide;yttrium |
| SMILES | Cn1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)c2cc(Br)n[c-]c21.[Y] |
| InChI | InChI=1S/C17H12BrClN3O2.Y/c1-22-9-13(16(23)12-6-15(18)20-8-14(12)22)17(24)21-7-10-2-4-11(19)5-3-10;/h2-6,9H,7H2,1H3,(H,21,24);/q-1; |
| InChIKey | RDBQEQQVKLEBQU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|