C26H25ClN2O4S — CID 11283366
N-[(4-chlorophenyl)methyl]-2-[[(3R)-3-hydroxy-3-phenylpropoxy]methyl]-7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide (PubChem CID 11283366) has the molecular formula C26H25ClN2O4S and a molecular weight of 497.02 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[[(3R)-3-hydroxy-3-phenylpropoxy]methyl]-7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[[(3R)-3-hydroxy-3-phenylpropoxy]methyl]-7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 11283366 |
| Molecular Formula | C26H25ClN2O4S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[[(3R)-3-hydroxy-3-phenylpropoxy]methyl]-7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide |
| SMILES | Cn1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)c2cc(COCC[C@@H](O)c3ccccc3)sc21 |
| InChI | InChI=1S/C26H25ClN2O4S/c1-29-15-22(25(32)28-14-17-7-9-19(27)10-8-17)24(31)21-13-20(34-26(21)29)16-33-12-11-23(30)18-5-3-2-4-6-18/h2-10,13,15,23,30H,11-12,14,16H2,1H3,(H,28,32)/t23-/m1/s1 |
| InChIKey | DYEQFIZCFMHZOI-HSZRJFAPSA-N |
| XLogP | 4.82 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|