C22H24ClN3O5S — CID 91316836
N-[(4-chlorophenyl)methyl]-2-[[3-(ethoxyamino)-2-oxopropoxy]methyl]-7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide (PubChem CID 91316836) has the molecular formula C22H24ClN3O5S and a molecular weight of 477.97 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[[3-(ethoxyamino)-2-oxopropoxy]methyl]-7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[[3-(ethoxyamino)-2-oxopropoxy]methyl]-7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 91316836 |
| Molecular Formula | C22H24ClN3O5S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[[3-(ethoxyamino)-2-oxopropoxy]methyl]-7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide |
| SMILES | CCONCC(=O)COCc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2s1 |
| InChI | InChI=1S/C22H24ClN3O5S/c1-3-31-25-10-16(27)12-30-13-17-8-18-20(28)19(11-26(2)22(18)32-17)21(29)24-9-14-4-6-15(23)7-5-14/h4-8,11,25H,3,9-10,12-13H2,1-2H3,(H,24,29) |
| InChIKey | FMFKZSKDZVDIFZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|